About oxepan-2-one;phenylselanylbenzene
oxepan-2-one;phenylselanylbenzene (PubChem CID 175535328) has the molecular formula C18H20O2Se
and a molecular weight of 347.32 g/mol. Its IUPAC name is oxepan-2-one;phenylselanylbenzene.
Molecular Properties
| Compound Name | oxepan-2-one;phenylselanylbenzene |
| PubChem CID | 175535328 |
| Molecular Formula | C18H20O2Se |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | oxepan-2-one;phenylselanylbenzene |
| SMILES | O=C1CCCCCO1.c1ccc([Se]c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10Se.C6H10O2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;7-6-4-2-1-3-5-8-6/h1-10H;1-5H2 |
| InChIKey | DCQKJERFLHMXLD-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze oxepan-2-one;phenylselanylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxepan-2-one;phenylselanylbenzene?
The IUPAC name of oxepan-2-one;phenylselanylbenzene (CID 175535328) is oxepan-2-one;phenylselanylbenzene.
What is the SMILES notation for oxepan-2-one;phenylselanylbenzene?
The canonical SMILES for oxepan-2-one;phenylselanylbenzene is O=C1CCCCCO1.c1ccc([Se]c2ccccc2)cc1.
What is the InChIKey of oxepan-2-one;phenylselanylbenzene?
The InChIKey is DCQKJERFLHMXLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10Se.C6H10O2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;7-6-4-2-1-3-5-8-6/h1-10H;1-5H2.
What are the key properties of oxepan-2-one;phenylselanylbenzene?
oxepan-2-one;phenylselanylbenzene has a molecular weight of 347.32 g/mol, XLogP of 2.45, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for oxepan-2-one;phenylselanylbenzene is sourced from PubChem (CID 175535328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).