About (3-ethyl-1,2-thiazol-4-yl) carbamate
(3-ethyl-1,2-thiazol-4-yl) carbamate (PubChem CID 175535886) has the molecular formula C6H8N2O2S
and a molecular weight of 172.21 g/mol. Its IUPAC name is (3-ethyl-1,2-thiazol-4-yl) carbamate.
Molecular Properties
| Compound Name | (3-ethyl-1,2-thiazol-4-yl) carbamate |
| PubChem CID | 175535886 |
| Molecular Formula | C6H8N2O2S |
| Molecular Weight | 172.21 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | (3-ethyl-1,2-thiazol-4-yl) carbamate |
| SMILES | CCc1nscc1OC(N)=O |
| InChI | InChI=1S/C6H8N2O2S/c1-2-4-5(3-11-8-4)10-6(7)9/h3H,2H2,1H3,(H2,7,9) |
| InChIKey | ZPCJRSGFAKATRU-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.21 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-ethyl-1,2-thiazol-4-yl) carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethyl-1,2-thiazol-4-yl) carbamate?
The IUPAC name of (3-ethyl-1,2-thiazol-4-yl) carbamate (CID 175535886) is (3-ethyl-1,2-thiazol-4-yl) carbamate.
What is the SMILES notation for (3-ethyl-1,2-thiazol-4-yl) carbamate?
The canonical SMILES for (3-ethyl-1,2-thiazol-4-yl) carbamate is CCc1nscc1OC(N)=O.
What is the InChIKey of (3-ethyl-1,2-thiazol-4-yl) carbamate?
The InChIKey is ZPCJRSGFAKATRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2S/c1-2-4-5(3-11-8-4)10-6(7)9/h3H,2H2,1H3,(H2,7,9).
What are the key properties of (3-ethyl-1,2-thiazol-4-yl) carbamate?
(3-ethyl-1,2-thiazol-4-yl) carbamate has a molecular weight of 172.21 g/mol, XLogP of 1.16, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethyl-1,2-thiazol-4-yl) carbamate is sourced from PubChem (CID 175535886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).