C8H5F4NO3 — CID 175535923
[5-(difluoromethoxy)-2,4-difluorophenyl] carbamate (PubChem CID 175535923) has the molecular formula C8H5F4NO3 and a molecular weight of 239.12 g/mol. Its IUPAC name is [5-(difluoromethoxy)-2,4-difluorophenyl] carbamate.
| Compound Name | [5-(difluoromethoxy)-2,4-difluorophenyl] carbamate |
|---|---|
| PubChem CID | 175535923 |
| Molecular Formula | C8H5F4NO3 |
| Molecular Weight | 239.12 g/mol |
| Exact Mass | 239.02 |
| IUPAC Name | [5-(difluoromethoxy)-2,4-difluorophenyl] carbamate |
| SMILES | NC(=O)Oc1cc(OC(F)F)c(F)cc1F |
| InChI | InChI=1S/C8H5F4NO3/c9-3-1-4(10)6(16-8(13)14)2-5(3)15-7(11)12/h1-2,7H,(H2,13,14) |
| InChIKey | OPOIFPBEHQFOJR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.12 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |