About [5-butyl-2-(ethylamino)-6-methylpyrimidin-4-yl] N,N-dimethylsulfamate;hydrochloride
[5-butyl-2-(ethylamino)-6-methylpyrimidin-4-yl] N,N-dimethylsulfamate;hydrochloride (PubChem CID 175536123) has the molecular formula C13H25ClN4O3S
and a molecular weight of 352.89 g/mol. Its IUPAC name is [5-butyl-2-(ethylamino)-6-methylpyrimidin-4-yl] N,N-dimethylsulfamate;hydrochloride.
Molecular Properties
| Compound Name | [5-butyl-2-(ethylamino)-6-methylpyrimidin-4-yl] N,N-dimethylsulfamate;hydrochloride |
| PubChem CID | 175536123 |
| Molecular Formula | C13H25ClN4O3S |
| Molecular Weight | 352.89 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | [5-butyl-2-(ethylamino)-6-methylpyrimidin-4-yl] N,N-dimethylsulfamate;hydrochloride |
| SMILES | CCCCc1c(C)nc(NCC)nc1OS(=O)(=O)N(C)C.Cl |
| InChI | InChI=1S/C13H24N4O3S.ClH/c1-6-8-9-11-10(3)15-13(14-7-2)16-12(11)20-21(18,19)17(4)5;/h6-9H2,1-5H3,(H,14,15,16);1H |
| InChIKey | DVBAOJGGSZCZHY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.89 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [5-butyl-2-(ethylamino)-6-methylpyrimidin-4-yl] N,N-dimethylsulfamate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-butyl-2-(ethylamino)-6-methylpyrimidin-4-yl] N,N-dimethylsulfamate;hydrochloride?
The IUPAC name of [5-butyl-2-(ethylamino)-6-methylpyrimidin-4-yl] N,N-dimethylsulfamate;hydrochloride (CID 175536123) is [5-butyl-2-(ethylamino)-6-methylpyrimidin-4-yl] N,N-dimethylsulfamate;hydrochloride.
What is the SMILES notation for [5-butyl-2-(ethylamino)-6-methylpyrimidin-4-yl] N,N-dimethylsulfamate;hydrochloride?
The canonical SMILES for [5-butyl-2-(ethylamino)-6-methylpyrimidin-4-yl] N,N-dimethylsulfamate;hydrochloride is CCCCc1c(C)nc(NCC)nc1OS(=O)(=O)N(C)C.Cl.
What is the InChIKey of [5-butyl-2-(ethylamino)-6-methylpyrimidin-4-yl] N,N-dimethylsulfamate;hydrochloride?
The InChIKey is DVBAOJGGSZCZHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N4O3S.ClH/c1-6-8-9-11-10(3)15-13(14-7-2)16-12(11)20-21(18,19)17(4)5;/h6-9H2,1-5H3,(H,14,15,16);1H.
What are the key properties of [5-butyl-2-(ethylamino)-6-methylpyrimidin-4-yl] N,N-dimethylsulfamate;hydrochloride?
[5-butyl-2-(ethylamino)-6-methylpyrimidin-4-yl] N,N-dimethylsulfamate;hydrochloride has a molecular weight of 352.89 g/mol, XLogP of 2.17, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-butyl-2-(ethylamino)-6-methylpyrimidin-4-yl] N,N-dimethylsulfamate;hydrochloride is sourced from PubChem (CID 175536123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).