About 3,4-dibutyl-2-phenyl-1-(triazin-4-yl)indolo[3,2-c]carbazole
3,4-dibutyl-2-phenyl-1-(triazin-4-yl)indolo[3,2-c]carbazole (PubChem CID 175536301) has the molecular formula C35H31N5
and a molecular weight of 521.67 g/mol. Its IUPAC name is 3,4-dibutyl-2-phenyl-1-(triazin-4-yl)indolo[3,2-c]carbazole.
Molecular Properties
| Compound Name | 3,4-dibutyl-2-phenyl-1-(triazin-4-yl)indolo[3,2-c]carbazole |
| PubChem CID | 175536301 |
| Molecular Formula | C35H31N5 |
| Molecular Weight | 521.67 g/mol |
| Exact Mass | 521.26 |
| IUPAC Name | 3,4-dibutyl-2-phenyl-1-(triazin-4-yl)indolo[3,2-c]carbazole |
| SMILES | CCCCc1c(CCCC)c(-c2ccccc2)c(-c2ccnnn2)c2c1N=c1ccc3c(c1-2)N=c1ccccc1=3 |
| InChI | InChI=1S/C35H31N5/c1-3-5-14-24-25(15-6-4-2)35-33(31(29-20-21-36-40-39-29)30(24)22-12-8-7-9-13-22)32-28(38-35)19-18-26-23-16-10-11-17-27(23)37-34(26)32/h7-13,16-21H,3-6,14-15H2,1-2H3 |
| InChIKey | AYRKVTMKRWHOHV-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 63.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 521.67 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3,4-dibutyl-2-phenyl-1-(triazin-4-yl)indolo[3,2-c]carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dibutyl-2-phenyl-1-(triazin-4-yl)indolo[3,2-c]carbazole?
The IUPAC name of 3,4-dibutyl-2-phenyl-1-(triazin-4-yl)indolo[3,2-c]carbazole (CID 175536301) is 3,4-dibutyl-2-phenyl-1-(triazin-4-yl)indolo[3,2-c]carbazole.
What is the SMILES notation for 3,4-dibutyl-2-phenyl-1-(triazin-4-yl)indolo[3,2-c]carbazole?
The canonical SMILES for 3,4-dibutyl-2-phenyl-1-(triazin-4-yl)indolo[3,2-c]carbazole is CCCCc1c(CCCC)c(-c2ccccc2)c(-c2ccnnn2)c2c1N=c1ccc3c(c1-2)N=c1ccccc1=3.
What is the InChIKey of 3,4-dibutyl-2-phenyl-1-(triazin-4-yl)indolo[3,2-c]carbazole?
The InChIKey is AYRKVTMKRWHOHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H31N5/c1-3-5-14-24-25(15-6-4-2)35-33(31(29-20-21-36-40-39-29)30(24)22-12-8-7-9-13-22)32-28(38-35)19-18-26-23-16-10-11-17-27(23)37-34(26)32/h7-13,16-21H,3-6,14-15H2,1-2H3.
What are the key properties of 3,4-dibutyl-2-phenyl-1-(triazin-4-yl)indolo[3,2-c]carbazole?
3,4-dibutyl-2-phenyl-1-(triazin-4-yl)indolo[3,2-c]carbazole has a molecular weight of 521.67 g/mol, XLogP of 7.37, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dibutyl-2-phenyl-1-(triazin-4-yl)indolo[3,2-c]carbazole is sourced from PubChem (CID 175536301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).