About oxolane;tetraethylazanium;fluoride
oxolane;tetraethylazanium;fluoride (PubChem CID 175536587) has the molecular formula C12H28FNO
and a molecular weight of 221.36 g/mol. Its IUPAC name is oxolane;tetraethylazanium;fluoride.
Molecular Properties
| Compound Name | oxolane;tetraethylazanium;fluoride |
| PubChem CID | 175536587 |
| Molecular Formula | C12H28FNO |
| Molecular Weight | 221.36 g/mol |
| Exact Mass | 221.22 |
| IUPAC Name | oxolane;tetraethylazanium;fluoride |
| SMILES | C1CCOC1.CC[N+](CC)(CC)CC.[F-] |
| InChI | InChI=1S/C8H20N.C4H8O.FH/c1-5-9(6-2,7-3)8-4;1-2-4-5-3-1;/h5-8H2,1-4H3;1-4H2;1H/q+1;;/p-1 |
| InChIKey | XNHLEQRWNFHOQA-UHFFFAOYSA-M |
| XLogP | -0.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.36 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze oxolane;tetraethylazanium;fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolane;tetraethylazanium;fluoride?
The IUPAC name of oxolane;tetraethylazanium;fluoride (CID 175536587) is oxolane;tetraethylazanium;fluoride.
What is the SMILES notation for oxolane;tetraethylazanium;fluoride?
The canonical SMILES for oxolane;tetraethylazanium;fluoride is C1CCOC1.CC[N+](CC)(CC)CC.[F-].
What is the InChIKey of oxolane;tetraethylazanium;fluoride?
The InChIKey is XNHLEQRWNFHOQA-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H20N.C4H8O.FH/c1-5-9(6-2,7-3)8-4;1-2-4-5-3-1;/h5-8H2,1-4H3;1-4H2;1H/q+1;;/p-1.
What are the key properties of oxolane;tetraethylazanium;fluoride?
oxolane;tetraethylazanium;fluoride has a molecular weight of 221.36 g/mol, XLogP of -0.32, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for oxolane;tetraethylazanium;fluoride is sourced from PubChem (CID 175536587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).