C8H4F12O — CID 175536602
4,4,5,5,5-pentafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)pentan-2-one (PubChem CID 175536602) has the molecular formula C8H4F12O and a molecular weight of 344.10 g/mol. Its IUPAC name is 4,4,5,5,5-pentafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)pentan-2-one.
| Compound Name | 4,4,5,5,5-pentafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)pentan-2-one |
|---|---|
| PubChem CID | 175536602 |
| Molecular Formula | C8H4F12O |
| Molecular Weight | 344.10 g/mol |
| Exact Mass | 344.01 |
| IUPAC Name | 4,4,5,5,5-pentafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)pentan-2-one |
| SMILES | CC(=O)C(C(F)(F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H4F12O/c1-2(21)3(5(10,11)8(18,19)20)4(9,6(12,13)14)7(15,16)17/h3H,1H3 |
| InChIKey | MXQBCJNAIOGZPZ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.10 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|