About [(E)-5-(3,6-dihydro-2H-pyran-4-yl)-1-(methylamino)-1-oxopent-4-en-2-yl] carbamate
[(E)-5-(3,6-dihydro-2H-pyran-4-yl)-1-(methylamino)-1-oxopent-4-en-2-yl] carbamate (PubChem CID 175536677) has the molecular formula C12H18N2O4
and a molecular weight of 254.29 g/mol. Its IUPAC name is [(E)-5-(3,6-dihydro-2H-pyran-4-yl)-1-(methylamino)-1-oxopent-4-en-2-yl] carbamate.
Molecular Properties
| Compound Name | [(E)-5-(3,6-dihydro-2H-pyran-4-yl)-1-(methylamino)-1-oxopent-4-en-2-yl] carbamate |
| PubChem CID | 175536677 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | [(E)-5-(3,6-dihydro-2H-pyran-4-yl)-1-(methylamino)-1-oxopent-4-en-2-yl] carbamate |
| SMILES | CNC(=O)C(C/C=C/C1=CCOCC1)OC(N)=O |
| InChI | InChI=1S/C12H18N2O4/c1-14-11(15)10(18-12(13)16)4-2-3-9-5-7-17-8-6-9/h2-3,5,10H,4,6-8H2,1H3,(H2,13,16)(H,14,15)/b3-2+ |
| InChIKey | RLIIGPXIIVNWNN-NSCUHMNNSA-N |
| XLogP | 0.49 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(E)-5-(3,6-dihydro-2H-pyran-4-yl)-1-(methylamino)-1-oxopent-4-en-2-yl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-5-(3,6-dihydro-2H-pyran-4-yl)-1-(methylamino)-1-oxopent-4-en-2-yl] carbamate?
The IUPAC name of [(E)-5-(3,6-dihydro-2H-pyran-4-yl)-1-(methylamino)-1-oxopent-4-en-2-yl] carbamate (CID 175536677) is [(E)-5-(3,6-dihydro-2H-pyran-4-yl)-1-(methylamino)-1-oxopent-4-en-2-yl] carbamate.
What is the SMILES notation for [(E)-5-(3,6-dihydro-2H-pyran-4-yl)-1-(methylamino)-1-oxopent-4-en-2-yl] carbamate?
The canonical SMILES for [(E)-5-(3,6-dihydro-2H-pyran-4-yl)-1-(methylamino)-1-oxopent-4-en-2-yl] carbamate is CNC(=O)C(C/C=C/C1=CCOCC1)OC(N)=O.
What is the InChIKey of [(E)-5-(3,6-dihydro-2H-pyran-4-yl)-1-(methylamino)-1-oxopent-4-en-2-yl] carbamate?
The InChIKey is RLIIGPXIIVNWNN-NSCUHMNNSA-N. The full InChI is InChI=1S/C12H18N2O4/c1-14-11(15)10(18-12(13)16)4-2-3-9-5-7-17-8-6-9/h2-3,5,10H,4,6-8H2,1H3,(H2,13,16)(H,14,15)/b3-2+.
What are the key properties of [(E)-5-(3,6-dihydro-2H-pyran-4-yl)-1-(methylamino)-1-oxopent-4-en-2-yl] carbamate?
[(E)-5-(3,6-dihydro-2H-pyran-4-yl)-1-(methylamino)-1-oxopent-4-en-2-yl] carbamate has a molecular weight of 254.29 g/mol, XLogP of 0.49, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-5-(3,6-dihydro-2H-pyran-4-yl)-1-(methylamino)-1-oxopent-4-en-2-yl] carbamate is sourced from PubChem (CID 175536677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).