About 2-[4-fluoro-2,6-di(propan-2-yl)phenyl]-3-sulfinylpropanamide
2-[4-fluoro-2,6-di(propan-2-yl)phenyl]-3-sulfinylpropanamide (PubChem CID 175537110) has the molecular formula C15H20FNO2S
and a molecular weight of 297.40 g/mol. Its IUPAC name is 2-[4-fluoro-2,6-di(propan-2-yl)phenyl]-3-sulfinylpropanamide.
Molecular Properties
| Compound Name | 2-[4-fluoro-2,6-di(propan-2-yl)phenyl]-3-sulfinylpropanamide |
| PubChem CID | 175537110 |
| Molecular Formula | C15H20FNO2S |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 2-[4-fluoro-2,6-di(propan-2-yl)phenyl]-3-sulfinylpropanamide |
| SMILES | CC(C)c1cc(F)cc(C(C)C)c1C(C=S=O)C(N)=O |
| InChI | InChI=1S/C15H20FNO2S/c1-8(2)11-5-10(16)6-12(9(3)4)14(11)13(7-20-19)15(17)18/h5-9,13H,1-4H3,(H2,17,18) |
| InChIKey | BSMCAXFYYSQTNC-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-fluoro-2,6-di(propan-2-yl)phenyl]-3-sulfinylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-fluoro-2,6-di(propan-2-yl)phenyl]-3-sulfinylpropanamide?
The IUPAC name of 2-[4-fluoro-2,6-di(propan-2-yl)phenyl]-3-sulfinylpropanamide (CID 175537110) is 2-[4-fluoro-2,6-di(propan-2-yl)phenyl]-3-sulfinylpropanamide.
What is the SMILES notation for 2-[4-fluoro-2,6-di(propan-2-yl)phenyl]-3-sulfinylpropanamide?
The canonical SMILES for 2-[4-fluoro-2,6-di(propan-2-yl)phenyl]-3-sulfinylpropanamide is CC(C)c1cc(F)cc(C(C)C)c1C(C=S=O)C(N)=O.
What is the InChIKey of 2-[4-fluoro-2,6-di(propan-2-yl)phenyl]-3-sulfinylpropanamide?
The InChIKey is BSMCAXFYYSQTNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20FNO2S/c1-8(2)11-5-10(16)6-12(9(3)4)14(11)13(7-20-19)15(17)18/h5-9,13H,1-4H3,(H2,17,18).
What are the key properties of 2-[4-fluoro-2,6-di(propan-2-yl)phenyl]-3-sulfinylpropanamide?
2-[4-fluoro-2,6-di(propan-2-yl)phenyl]-3-sulfinylpropanamide has a molecular weight of 297.40 g/mol, XLogP of 2.66, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-fluoro-2,6-di(propan-2-yl)phenyl]-3-sulfinylpropanamide is sourced from PubChem (CID 175537110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).