About alumane;oxaldehydic acid;tetrachlorozirconium
alumane;oxaldehydic acid;tetrachlorozirconium (PubChem CID 175537175) has the molecular formula C2H5AlCl4O3Zr
and a molecular weight of 337.08 g/mol. Its IUPAC name is alumane;oxaldehydic acid;tetrachlorozirconium.
Molecular Properties
| Compound Name | alumane;oxaldehydic acid;tetrachlorozirconium |
| PubChem CID | 175537175 |
| Molecular Formula | C2H5AlCl4O3Zr |
| Molecular Weight | 337.08 g/mol |
| Exact Mass | 333.79 |
| IUPAC Name | alumane;oxaldehydic acid;tetrachlorozirconium |
| SMILES | Cl[Zr](Cl)(Cl)Cl.O=CC(=O)O.[AlH3] |
| InChI | InChI=1S/C2H2O3.Al.4ClH.Zr.3H/c3-1-2(4)5;;;;;;;;;/h1H,(H,4,5);;4*1H;;;;/q;;;;;;+4;;;/p-4 |
| InChIKey | UHGJTVCSOMUTBJ-UHFFFAOYSA-J |
| XLogP | 0.84 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.08 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze alumane;oxaldehydic acid;tetrachlorozirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of alumane;oxaldehydic acid;tetrachlorozirconium?
The IUPAC name of alumane;oxaldehydic acid;tetrachlorozirconium (CID 175537175) is alumane;oxaldehydic acid;tetrachlorozirconium.
What is the SMILES notation for alumane;oxaldehydic acid;tetrachlorozirconium?
The canonical SMILES for alumane;oxaldehydic acid;tetrachlorozirconium is Cl[Zr](Cl)(Cl)Cl.O=CC(=O)O.[AlH3].
What is the InChIKey of alumane;oxaldehydic acid;tetrachlorozirconium?
The InChIKey is UHGJTVCSOMUTBJ-UHFFFAOYSA-J. The full InChI is InChI=1S/C2H2O3.Al.4ClH.Zr.3H/c3-1-2(4)5;;;;;;;;;/h1H,(H,4,5);;4*1H;;;;/q;;;;;;+4;;;/p-4.
What are the key properties of alumane;oxaldehydic acid;tetrachlorozirconium?
alumane;oxaldehydic acid;tetrachlorozirconium has a molecular weight of 337.08 g/mol, XLogP of 0.84, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for alumane;oxaldehydic acid;tetrachlorozirconium is sourced from PubChem (CID 175537175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).