C22H17FO10 — CID 175537255
3-[(2R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl]-2-fluoro-4,5-dihydroxybenzoic acid (PubChem CID 175537255) has the molecular formula C22H17FO10 and a molecular weight of 460.37 g/mol. Its IUPAC name is 3-[(2R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl]-2-fluoro-4,5-dihydroxybenzoic acid.
| Compound Name | 3-[(2R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl]-2-fluoro-4,5-dihydroxybenzoic acid |
|---|---|
| PubChem CID | 175537255 |
| Molecular Formula | C22H17FO10 |
| Molecular Weight | 460.37 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | 3-[(2R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl]-2-fluoro-4,5-dihydroxybenzoic acid |
| SMILES | O=C(O)c1cc(O)c(O)c(C2Cc3c(O)cc(O)cc3O[C@H]2c2cc(O)c(O)c(O)c2)c1F |
| InChI | InChI=1S/C22H17FO10/c23-18-11(22(31)32)6-15(28)20(30)17(18)10-5-9-12(25)3-8(24)4-16(9)33-21(10)7-1-13(26)19(29)14(27)2-7/h1-4,6,10,21,24-30H,5H2,(H,31,32)/t10?,21-/m0/s1 |
| InChIKey | YPZFOYOVSLXTPC-MNKSETBFSA-N |
| XLogP | 2.92 |
| TPSA | 188.14 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|