C25H22FNO12 — CID 175537306
[(2R)-2-[4-(ethylcarbamoyloxy)-3,5-dihydroxyphenyl]-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl] 2-fluoro-3,4,5-trihydroxybenzoate (PubChem CID 175537306) has the molecular formula C25H22FNO12 and a molecular weight of 547.44 g/mol. Its IUPAC name is [(2R)-2-[4-(ethylcarbamoyloxy)-3,5-dihydroxyphenyl]-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl] 2-fluoro-3,4,5-trihydroxybenzoate.
| Compound Name | [(2R)-2-[4-(ethylcarbamoyloxy)-3,5-dihydroxyphenyl]-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl] 2-fluoro-3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 175537306 |
| Molecular Formula | C25H22FNO12 |
| Molecular Weight | 547.44 g/mol |
| Exact Mass | 547.11 |
| IUPAC Name | [(2R)-2-[4-(ethylcarbamoyloxy)-3,5-dihydroxyphenyl]-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl] 2-fluoro-3,4,5-trihydroxybenzoate |
| SMILES | CCNC(=O)Oc1c(O)cc([C@H]2Oc3cc(O)cc(O)c3CC2OC(=O)c2cc(O)c(O)c(O)c2F)cc1O |
| InChI | InChI=1S/C25H22FNO12/c1-2-27-25(36)39-23-15(31)3-9(4-16(23)32)22-18(8-11-13(29)5-10(28)6-17(11)37-22)38-24(35)12-7-14(30)20(33)21(34)19(12)26/h3-7,18,22,28-34H,2,8H2,1H3,(H,27,36)/t18?,22-/m1/s1 |
| InChIKey | QYIVWUDIKVKGKQ-LMNIDFBRSA-N |
| XLogP | 2.78 |
| TPSA | 215.47 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|