C24H39N5O6S2 — CID 175538036
tert-butyl N-ethylcarbamate;N-[5-[4-methoxy-3-(sulfamoylamino)phenyl]-4-methyl-1,3-thiazol-2-yl]hexanamide (PubChem CID 175538036) has the molecular formula C24H39N5O6S2 and a molecular weight of 557.74 g/mol. Its IUPAC name is tert-butyl N-ethylcarbamate;N-[5-[4-methoxy-3-(sulfamoylamino)phenyl]-4-methyl-1,3-thiazol-2-yl]hexanamide.
| Compound Name | tert-butyl N-ethylcarbamate;N-[5-[4-methoxy-3-(sulfamoylamino)phenyl]-4-methyl-1,3-thiazol-2-yl]hexanamide |
|---|---|
| PubChem CID | 175538036 |
| Molecular Formula | C24H39N5O6S2 |
| Molecular Weight | 557.74 g/mol |
| Exact Mass | 557.23 |
| IUPAC Name | tert-butyl N-ethylcarbamate;N-[5-[4-methoxy-3-(sulfamoylamino)phenyl]-4-methyl-1,3-thiazol-2-yl]hexanamide |
| SMILES | CCCCCC(=O)Nc1nc(C)c(-c2ccc(OC)c(NS(N)(=O)=O)c2)s1.CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H24N4O4S2.C7H15NO2/c1-4-5-6-7-15(22)20-17-19-11(2)16(26-17)12-8-9-14(25-3)13(10-12)21-27(18,23)24;1-5-8-6(9)10-7(2,3)4/h8-10,21H,4-7H2,1-3H3,(H2,18,23,24)(H,19,20,22);5H2,1-4H3,(H,8,9) |
| InChIKey | ZECLOYBPUDAPQJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 161.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.74 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|