C11H15N3O7 — CID 175538459
N-[[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]methyl]formamide (PubChem CID 175538459) has the molecular formula C11H15N3O7 and a molecular weight of 301.26 g/mol. Its IUPAC name is N-[[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]methyl]formamide.
| Compound Name | N-[[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]methyl]formamide |
|---|---|
| PubChem CID | 175538459 |
| Molecular Formula | C11H15N3O7 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | N-[[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]methyl]formamide |
| SMILES | O=CNCc1cn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H15N3O7/c15-3-6-7(17)8(18)10(21-6)14-2-5(1-12-4-16)9(19)13-11(14)20/h2,4,6-8,10,15,17-18H,1,3H2,(H,12,16)(H,13,19,20)/t6-,7-,8-,10-/m1/s1 |
| InChIKey | HCKGOXDJSHAPSL-FDDDBJFASA-N |
| XLogP | -3.61 |
| TPSA | 153.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | -3.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|