C17H16N2O3S — CID 175538760
5-[1-hydroxy-2-(3-phenoxyanilino)ethyl]-3H-1,3-oxazole-2-thione (PubChem CID 175538760) has the molecular formula C17H16N2O3S and a molecular weight of 328.39 g/mol. Its IUPAC name is 5-[1-hydroxy-2-(3-phenoxyanilino)ethyl]-3H-1,3-oxazole-2-thione.
| Compound Name | 5-[1-hydroxy-2-(3-phenoxyanilino)ethyl]-3H-1,3-oxazole-2-thione |
|---|---|
| PubChem CID | 175538760 |
| Molecular Formula | C17H16N2O3S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 5-[1-hydroxy-2-(3-phenoxyanilino)ethyl]-3H-1,3-oxazole-2-thione |
| SMILES | OC(CNc1cccc(Oc2ccccc2)c1)c1c[nH]c(=S)o1 |
| InChI | InChI=1S/C17H16N2O3S/c20-15(16-11-19-17(23)22-16)10-18-12-5-4-8-14(9-12)21-13-6-2-1-3-7-13/h1-9,11,15,18,20H,10H2,(H,19,23) |
| InChIKey | YZTONUZOROMXLY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|