About N-[2-hydroxy-2-(2-oxo-1,3-dihydroimidazol-4-yl)ethyl]acetamide
N-[2-hydroxy-2-(2-oxo-1,3-dihydroimidazol-4-yl)ethyl]acetamide (PubChem CID 175538821) has the molecular formula C7H11N3O3
and a molecular weight of 185.18 g/mol. Its IUPAC name is N-[2-hydroxy-2-(2-oxo-1,3-dihydroimidazol-4-yl)ethyl]acetamide.
Molecular Properties
| Compound Name | N-[2-hydroxy-2-(2-oxo-1,3-dihydroimidazol-4-yl)ethyl]acetamide |
| PubChem CID | 175538821 |
| Molecular Formula | C7H11N3O3 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | N-[2-hydroxy-2-(2-oxo-1,3-dihydroimidazol-4-yl)ethyl]acetamide |
| SMILES | CC(=O)NCC(O)c1c[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C7H11N3O3/c1-4(11)8-3-6(12)5-2-9-7(13)10-5/h2,6,12H,3H2,1H3,(H,8,11)(H2,9,10,13) |
| InChIKey | GRXPRTLDSOILMI-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-hydroxy-2-(2-oxo-1,3-dihydroimidazol-4-yl)ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-hydroxy-2-(2-oxo-1,3-dihydroimidazol-4-yl)ethyl]acetamide?
The IUPAC name of N-[2-hydroxy-2-(2-oxo-1,3-dihydroimidazol-4-yl)ethyl]acetamide (CID 175538821) is N-[2-hydroxy-2-(2-oxo-1,3-dihydroimidazol-4-yl)ethyl]acetamide.
What is the SMILES notation for N-[2-hydroxy-2-(2-oxo-1,3-dihydroimidazol-4-yl)ethyl]acetamide?
The canonical SMILES for N-[2-hydroxy-2-(2-oxo-1,3-dihydroimidazol-4-yl)ethyl]acetamide is CC(=O)NCC(O)c1c[nH]c(=O)[nH]1.
What is the InChIKey of N-[2-hydroxy-2-(2-oxo-1,3-dihydroimidazol-4-yl)ethyl]acetamide?
The InChIKey is GRXPRTLDSOILMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O3/c1-4(11)8-3-6(12)5-2-9-7(13)10-5/h2,6,12H,3H2,1H3,(H,8,11)(H2,9,10,13).
What are the key properties of N-[2-hydroxy-2-(2-oxo-1,3-dihydroimidazol-4-yl)ethyl]acetamide?
N-[2-hydroxy-2-(2-oxo-1,3-dihydroimidazol-4-yl)ethyl]acetamide has a molecular weight of 185.18 g/mol, XLogP of -1.13, 3 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-hydroxy-2-(2-oxo-1,3-dihydroimidazol-4-yl)ethyl]acetamide is sourced from PubChem (CID 175538821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).