About 4-[1-hydroxy-2-(2-phenylanilino)ethyl]-1,3-dihydroimidazol-2-one
4-[1-hydroxy-2-(2-phenylanilino)ethyl]-1,3-dihydroimidazol-2-one (PubChem CID 175538860) has the molecular formula C17H17N3O2
and a molecular weight of 295.34 g/mol. Its IUPAC name is 4-[1-hydroxy-2-(2-phenylanilino)ethyl]-1,3-dihydroimidazol-2-one.
Molecular Properties
| Compound Name | 4-[1-hydroxy-2-(2-phenylanilino)ethyl]-1,3-dihydroimidazol-2-one |
| PubChem CID | 175538860 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 4-[1-hydroxy-2-(2-phenylanilino)ethyl]-1,3-dihydroimidazol-2-one |
| SMILES | O=c1[nH]cc(C(O)CNc2ccccc2-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C17H17N3O2/c21-16(15-10-19-17(22)20-15)11-18-14-9-5-4-8-13(14)12-6-2-1-3-7-12/h1-10,16,18,21H,11H2,(H2,19,20,22) |
| InChIKey | NPBGLWPRPHONFA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[1-hydroxy-2-(2-phenylanilino)ethyl]-1,3-dihydroimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-hydroxy-2-(2-phenylanilino)ethyl]-1,3-dihydroimidazol-2-one?
The IUPAC name of 4-[1-hydroxy-2-(2-phenylanilino)ethyl]-1,3-dihydroimidazol-2-one (CID 175538860) is 4-[1-hydroxy-2-(2-phenylanilino)ethyl]-1,3-dihydroimidazol-2-one.
What is the SMILES notation for 4-[1-hydroxy-2-(2-phenylanilino)ethyl]-1,3-dihydroimidazol-2-one?
The canonical SMILES for 4-[1-hydroxy-2-(2-phenylanilino)ethyl]-1,3-dihydroimidazol-2-one is O=c1[nH]cc(C(O)CNc2ccccc2-c2ccccc2)[nH]1.
What is the InChIKey of 4-[1-hydroxy-2-(2-phenylanilino)ethyl]-1,3-dihydroimidazol-2-one?
The InChIKey is NPBGLWPRPHONFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N3O2/c21-16(15-10-19-17(22)20-15)11-18-14-9-5-4-8-13(14)12-6-2-1-3-7-12/h1-10,16,18,21H,11H2,(H2,19,20,22).
What are the key properties of 4-[1-hydroxy-2-(2-phenylanilino)ethyl]-1,3-dihydroimidazol-2-one?
4-[1-hydroxy-2-(2-phenylanilino)ethyl]-1,3-dihydroimidazol-2-one has a molecular weight of 295.34 g/mol, XLogP of 2.52, 5 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-hydroxy-2-(2-phenylanilino)ethyl]-1,3-dihydroimidazol-2-one is sourced from PubChem (CID 175538860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).