C27H32F3N3O4Si — CID 175540835
(2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol (PubChem CID 175540835) has the molecular formula C27H32F3N3O4Si and a molecular weight of 547.65 g/mol. Its IUPAC name is (2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol.
| Compound Name | (2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol |
|---|---|
| PubChem CID | 175540835 |
| Molecular Formula | C27H32F3N3O4Si |
| Molecular Weight | 547.65 g/mol |
| Exact Mass | 547.21 |
| IUPAC Name | (2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol |
| SMILES | CC(C)(C)[Si](OC[C@@H]1OCC(Nc2cncc(C(F)(F)F)n2)C(O)C1O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H32F3N3O4Si/c1-26(2,3)38(18-10-6-4-7-11-18,19-12-8-5-9-13-19)37-17-21-25(35)24(34)20(16-36-21)32-23-15-31-14-22(33-23)27(28,29)30/h4-15,20-21,24-25,34-35H,16-17H2,1-3H3,(H,32,33)/t20?,21-,24?,25?/m0/s1 |
| InChIKey | YPJXPUIGFMSAIJ-MVPSRNBRSA-N |
| XLogP | 2.97 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.65 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|