C17H20F4N4OS — CID 175541102
7-[(3-fluoro-1-methylpiperidin-4-yl)amino]-N'-hydroxy-3-(1,2,2-trifluoroethyl)-1-benzothiophene-2-carboximidamide (PubChem CID 175541102) has the molecular formula C17H20F4N4OS and a molecular weight of 404.43 g/mol. Its IUPAC name is 7-[(3-fluoro-1-methylpiperidin-4-yl)amino]-N'-hydroxy-3-(1,2,2-trifluoroethyl)-1-benzothiophene-2-carboximidamide.
| Compound Name | 7-[(3-fluoro-1-methylpiperidin-4-yl)amino]-N'-hydroxy-3-(1,2,2-trifluoroethyl)-1-benzothiophene-2-carboximidamide |
|---|---|
| PubChem CID | 175541102 |
| Molecular Formula | C17H20F4N4OS |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 7-[(3-fluoro-1-methylpiperidin-4-yl)amino]-N'-hydroxy-3-(1,2,2-trifluoroethyl)-1-benzothiophene-2-carboximidamide |
| SMILES | CN1CCC(Nc2cccc3c(C(F)C(F)F)c(C(N)=NO)sc23)C(F)C1 |
| InChI | InChI=1S/C17H20F4N4OS/c1-25-6-5-10(9(18)7-25)23-11-4-2-3-8-12(13(19)16(20)21)15(17(22)24-26)27-14(8)11/h2-4,9-10,13,16,23,26H,5-7H2,1H3,(H2,22,24) |
| InChIKey | NRSVCMAJTVDCAJ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 73.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|