C9H8F4N2O — CID 175541224
1,3,4,5-tetrafluoro-1-N-methyl-2-benzofuran-1,3-diamine (PubChem CID 175541224) has the molecular formula C9H8F4N2O and a molecular weight of 236.17 g/mol. Its IUPAC name is 1,3,4,5-tetrafluoro-1-N-methyl-2-benzofuran-1,3-diamine.
| Compound Name | 1,3,4,5-tetrafluoro-1-N-methyl-2-benzofuran-1,3-diamine |
|---|---|
| PubChem CID | 175541224 |
| Molecular Formula | C9H8F4N2O |
| Molecular Weight | 236.17 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 1,3,4,5-tetrafluoro-1-N-methyl-2-benzofuran-1,3-diamine |
| SMILES | CNC1(F)OC(N)(F)c2c1ccc(F)c2F |
| InChI | InChI=1S/C9H8F4N2O/c1-15-9(13)4-2-3-5(10)7(11)6(4)8(12,14)16-9/h2-3,15H,14H2,1H3 |
| InChIKey | DMJHLSCUHDAIST-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.17 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|