About hydron;5-pyridin-4-ylpyridine-2-carboxamide
hydron;5-pyridin-4-ylpyridine-2-carboxamide (PubChem CID 175541988) has the molecular formula C11H10N3O+
and a molecular weight of 200.22 g/mol. Its IUPAC name is hydron;5-pyridin-4-ylpyridine-2-carboxamide.
Molecular Properties
| Compound Name | hydron;5-pyridin-4-ylpyridine-2-carboxamide |
| PubChem CID | 175541988 |
| Molecular Formula | C11H10N3O+ |
| Molecular Weight | 200.22 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | hydron;5-pyridin-4-ylpyridine-2-carboxamide |
| SMILES | NC(=O)c1ccc(-c2ccncc2)cn1.[H+] |
| InChI | InChI=1S/C11H9N3O/c12-11(15)10-2-1-9(7-14-10)8-3-5-13-6-4-8/h1-7H,(H2,12,15)/p+1 |
| InChIKey | YMBJMTRGFDPHEU-UHFFFAOYSA-O |
| XLogP | 1.36 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.22 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze hydron;5-pyridin-4-ylpyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;5-pyridin-4-ylpyridine-2-carboxamide?
The IUPAC name of hydron;5-pyridin-4-ylpyridine-2-carboxamide (CID 175541988) is hydron;5-pyridin-4-ylpyridine-2-carboxamide.
What is the SMILES notation for hydron;5-pyridin-4-ylpyridine-2-carboxamide?
The canonical SMILES for hydron;5-pyridin-4-ylpyridine-2-carboxamide is NC(=O)c1ccc(-c2ccncc2)cn1.[H+].
What is the InChIKey of hydron;5-pyridin-4-ylpyridine-2-carboxamide?
The InChIKey is YMBJMTRGFDPHEU-UHFFFAOYSA-O. The full InChI is InChI=1S/C11H9N3O/c12-11(15)10-2-1-9(7-14-10)8-3-5-13-6-4-8/h1-7H,(H2,12,15)/p+1.
What are the key properties of hydron;5-pyridin-4-ylpyridine-2-carboxamide?
hydron;5-pyridin-4-ylpyridine-2-carboxamide has a molecular weight of 200.22 g/mol, XLogP of 1.36, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;5-pyridin-4-ylpyridine-2-carboxamide is sourced from PubChem (CID 175541988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).