C7H13F4N3 — CID 175541994
1,1,2-trimethyl-3-(1,2,3,3-tetrafluoropropyl)guanidine (PubChem CID 175541994) has the molecular formula C7H13F4N3 and a molecular weight of 215.19 g/mol. Its IUPAC name is 1,1,2-trimethyl-3-(1,2,3,3-tetrafluoropropyl)guanidine.
| Compound Name | 1,1,2-trimethyl-3-(1,2,3,3-tetrafluoropropyl)guanidine |
|---|---|
| PubChem CID | 175541994 |
| Molecular Formula | C7H13F4N3 |
| Molecular Weight | 215.19 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | 1,1,2-trimethyl-3-(1,2,3,3-tetrafluoropropyl)guanidine |
| SMILES | C/N=C(/NC(F)C(F)C(F)F)N(C)C |
| InChI | InChI=1S/C7H13F4N3/c1-12-7(14(2)3)13-6(11)4(8)5(9)10/h4-6H,1-3H3,(H,12,13) |
| InChIKey | LOXGBAQLNRTWCP-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.19 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|