About pyrrol-1-yl N-methylcarbamate
pyrrol-1-yl N-methylcarbamate (PubChem CID 175542135) has the molecular formula C6H8N2O2
and a molecular weight of 140.14 g/mol. Its IUPAC name is pyrrol-1-yl N-methylcarbamate.
Molecular Properties
| Compound Name | pyrrol-1-yl N-methylcarbamate |
| PubChem CID | 175542135 |
| Molecular Formula | C6H8N2O2 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | pyrrol-1-yl N-methylcarbamate |
| SMILES | CNC(=O)On1cccc1 |
| InChI | InChI=1S/C6H8N2O2/c1-7-6(9)10-8-4-2-3-5-8/h2-5H,1H3,(H,7,9) |
| InChIKey | GXRRHGAUXXWJDS-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyrrol-1-yl N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrol-1-yl N-methylcarbamate?
The IUPAC name of pyrrol-1-yl N-methylcarbamate (CID 175542135) is pyrrol-1-yl N-methylcarbamate.
What is the SMILES notation for pyrrol-1-yl N-methylcarbamate?
The canonical SMILES for pyrrol-1-yl N-methylcarbamate is CNC(=O)On1cccc1.
What is the InChIKey of pyrrol-1-yl N-methylcarbamate?
The InChIKey is GXRRHGAUXXWJDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2/c1-7-6(9)10-8-4-2-3-5-8/h2-5H,1H3,(H,7,9).
What are the key properties of pyrrol-1-yl N-methylcarbamate?
pyrrol-1-yl N-methylcarbamate has a molecular weight of 140.14 g/mol, XLogP of 0.26, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrol-1-yl N-methylcarbamate is sourced from PubChem (CID 175542135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).