C11H20N2O2 — CID 175542912
[1-[(2R)-7-azabicyclo[2.2.1]heptan-2-yl]-2-methylpropan-2-yl]carbamic acid (PubChem CID 175542912) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is [1-[(2R)-7-azabicyclo[2.2.1]heptan-2-yl]-2-methylpropan-2-yl]carbamic acid.
| Compound Name | [1-[(2R)-7-azabicyclo[2.2.1]heptan-2-yl]-2-methylpropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 175542912 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | [1-[(2R)-7-azabicyclo[2.2.1]heptan-2-yl]-2-methylpropan-2-yl]carbamic acid |
| SMILES | CC(C)(C[C@H]1CC2CCC1N2)NC(=O)O |
| InChI | InChI=1S/C11H20N2O2/c1-11(2,13-10(14)15)6-7-5-8-3-4-9(7)12-8/h7-9,12-13H,3-6H2,1-2H3,(H,14,15)/t7-,8?,9?/m1/s1 |
| InChIKey | XMSZPDPCXOKLDE-AFPNSQJFSA-N |
| XLogP | 1.56 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |