C15H13NO3S — CID 175543565
[2-(2-formylphenyl)-3-sulfanylphenyl]methylcarbamic acid (PubChem CID 175543565) has the molecular formula C15H13NO3S and a molecular weight of 287.34 g/mol. Its IUPAC name is [2-(2-formylphenyl)-3-sulfanylphenyl]methylcarbamic acid.
| Compound Name | [2-(2-formylphenyl)-3-sulfanylphenyl]methylcarbamic acid |
|---|---|
| PubChem CID | 175543565 |
| Molecular Formula | C15H13NO3S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | [2-(2-formylphenyl)-3-sulfanylphenyl]methylcarbamic acid |
| SMILES | O=Cc1ccccc1-c1c(S)cccc1CNC(=O)O |
| InChI | InChI=1S/C15H13NO3S/c17-9-11-4-1-2-6-12(11)14-10(8-16-15(18)19)5-3-7-13(14)20/h1-7,9,16,20H,8H2,(H,18,19) |
| InChIKey | XKXVTDHHPWBSHI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|