About diphenylmethanethione;pyrrolidine
diphenylmethanethione;pyrrolidine (PubChem CID 175544055) has the molecular formula C17H19NS
and a molecular weight of 269.41 g/mol. Its IUPAC name is diphenylmethanethione;pyrrolidine.
Molecular Properties
| Compound Name | diphenylmethanethione;pyrrolidine |
| PubChem CID | 175544055 |
| Molecular Formula | C17H19NS |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | diphenylmethanethione;pyrrolidine |
| SMILES | C1CCNC1.S=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H10S.C4H9N/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-2-4-5-3-1/h1-10H;5H,1-4H2 |
| InChIKey | BIHGDSHFUCTJAW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze diphenylmethanethione;pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylmethanethione;pyrrolidine?
The IUPAC name of diphenylmethanethione;pyrrolidine (CID 175544055) is diphenylmethanethione;pyrrolidine.
What is the SMILES notation for diphenylmethanethione;pyrrolidine?
The canonical SMILES for diphenylmethanethione;pyrrolidine is C1CCNC1.S=C(c1ccccc1)c1ccccc1.
What is the InChIKey of diphenylmethanethione;pyrrolidine?
The InChIKey is BIHGDSHFUCTJAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10S.C4H9N/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-2-4-5-3-1/h1-10H;5H,1-4H2.
What are the key properties of diphenylmethanethione;pyrrolidine?
diphenylmethanethione;pyrrolidine has a molecular weight of 269.41 g/mol, XLogP of 3.82, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylmethanethione;pyrrolidine is sourced from PubChem (CID 175544055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).