C31H22O — CID 175545610
dibenzofuran;1-phenyl-9H-fluorene (PubChem CID 175545610) has the molecular formula C31H22O and a molecular weight of 410.52 g/mol. Its IUPAC name is dibenzofuran;1-phenyl-9H-fluorene.
| Compound Name | dibenzofuran;1-phenyl-9H-fluorene |
|---|---|
| PubChem CID | 175545610 |
| Molecular Formula | C31H22O |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | dibenzofuran;1-phenyl-9H-fluorene |
| SMILES | c1ccc(-c2cccc3c2Cc2ccccc2-3)cc1.c1ccc2c(c1)oc1ccccc12 |
| InChI | InChI=1S/C19H14.C12H8O/c1-2-7-14(8-3-1)16-11-6-12-18-17-10-5-4-9-15(17)13-19(16)18;1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1-12H,13H2;1-8H |
| InChIKey | UQWYMLPWWVQGQK-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |