About (2-methylpropan-2-yl)oxyphosphane;7-oxabicyclo[4.1.0]hepta-1,3,5-triene;hydrochloride
(2-methylpropan-2-yl)oxyphosphane;7-oxabicyclo[4.1.0]hepta-1,3,5-triene;hydrochloride (PubChem CID 175546555) has the molecular formula C10H16ClO2P
and a molecular weight of 234.66 g/mol. Its IUPAC name is (2-methylpropan-2-yl)oxyphosphane;7-oxabicyclo[4.1.0]hepta-1,3,5-triene;hydrochloride.
Molecular Properties
| Compound Name | (2-methylpropan-2-yl)oxyphosphane;7-oxabicyclo[4.1.0]hepta-1,3,5-triene;hydrochloride |
| PubChem CID | 175546555 |
| Molecular Formula | C10H16ClO2P |
| Molecular Weight | 234.66 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | (2-methylpropan-2-yl)oxyphosphane;7-oxabicyclo[4.1.0]hepta-1,3,5-triene;hydrochloride |
| SMILES | CC(C)(C)OP.Cl.c1ccc2c(c1)O2 |
| InChI | InChI=1S/C6H4O.C4H11OP.ClH/c1-2-4-6-5(3-1)7-6;1-4(2,3)5-6;/h1-4H;6H2,1-3H3;1H |
| InChIKey | GYHDJTSNLHFEHL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.66 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2-methylpropan-2-yl)oxyphosphane;7-oxabicyclo[4.1.0]hepta-1,3,5-triene;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylpropan-2-yl)oxyphosphane;7-oxabicyclo[4.1.0]hepta-1,3,5-triene;hydrochloride?
The IUPAC name of (2-methylpropan-2-yl)oxyphosphane;7-oxabicyclo[4.1.0]hepta-1,3,5-triene;hydrochloride (CID 175546555) is (2-methylpropan-2-yl)oxyphosphane;7-oxabicyclo[4.1.0]hepta-1,3,5-triene;hydrochloride.
What is the SMILES notation for (2-methylpropan-2-yl)oxyphosphane;7-oxabicyclo[4.1.0]hepta-1,3,5-triene;hydrochloride?
The canonical SMILES for (2-methylpropan-2-yl)oxyphosphane;7-oxabicyclo[4.1.0]hepta-1,3,5-triene;hydrochloride is CC(C)(C)OP.Cl.c1ccc2c(c1)O2.
What is the InChIKey of (2-methylpropan-2-yl)oxyphosphane;7-oxabicyclo[4.1.0]hepta-1,3,5-triene;hydrochloride?
The InChIKey is GYHDJTSNLHFEHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4O.C4H11OP.ClH/c1-2-4-6-5(3-1)7-6;1-4(2,3)5-6;/h1-4H;6H2,1-3H3;1H.
What are the key properties of (2-methylpropan-2-yl)oxyphosphane;7-oxabicyclo[4.1.0]hepta-1,3,5-triene;hydrochloride?
(2-methylpropan-2-yl)oxyphosphane;7-oxabicyclo[4.1.0]hepta-1,3,5-triene;hydrochloride has a molecular weight of 234.66 g/mol, XLogP of 3.81, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylpropan-2-yl)oxyphosphane;7-oxabicyclo[4.1.0]hepta-1,3,5-triene;hydrochloride is sourced from PubChem (CID 175546555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).