About N-tert-butyl-4,6-dimethoxy-N-methyl-1,3-benzothiazole-2-sulfonamide
N-tert-butyl-4,6-dimethoxy-N-methyl-1,3-benzothiazole-2-sulfonamide (PubChem CID 175547377) has the molecular formula C14H20N2O4S2
and a molecular weight of 344.46 g/mol. Its IUPAC name is N-tert-butyl-4,6-dimethoxy-N-methyl-1,3-benzothiazole-2-sulfonamide.
Molecular Properties
| Compound Name | N-tert-butyl-4,6-dimethoxy-N-methyl-1,3-benzothiazole-2-sulfonamide |
| PubChem CID | 175547377 |
| Molecular Formula | C14H20N2O4S2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | N-tert-butyl-4,6-dimethoxy-N-methyl-1,3-benzothiazole-2-sulfonamide |
| SMILES | COc1cc(OC)c2nc(S(=O)(=O)N(C)C(C)(C)C)sc2c1 |
| InChI | InChI=1S/C14H20N2O4S2/c1-14(2,3)16(4)22(17,18)13-15-12-10(20-6)7-9(19-5)8-11(12)21-13/h7-8H,1-6H3 |
| InChIKey | VVVMDWHFVRDCGW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-tert-butyl-4,6-dimethoxy-N-methyl-1,3-benzothiazole-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-4,6-dimethoxy-N-methyl-1,3-benzothiazole-2-sulfonamide?
The IUPAC name of N-tert-butyl-4,6-dimethoxy-N-methyl-1,3-benzothiazole-2-sulfonamide (CID 175547377) is N-tert-butyl-4,6-dimethoxy-N-methyl-1,3-benzothiazole-2-sulfonamide.
What is the SMILES notation for N-tert-butyl-4,6-dimethoxy-N-methyl-1,3-benzothiazole-2-sulfonamide?
The canonical SMILES for N-tert-butyl-4,6-dimethoxy-N-methyl-1,3-benzothiazole-2-sulfonamide is COc1cc(OC)c2nc(S(=O)(=O)N(C)C(C)(C)C)sc2c1.
What is the InChIKey of N-tert-butyl-4,6-dimethoxy-N-methyl-1,3-benzothiazole-2-sulfonamide?
The InChIKey is VVVMDWHFVRDCGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O4S2/c1-14(2,3)16(4)22(17,18)13-15-12-10(20-6)7-9(19-5)8-11(12)21-13/h7-8H,1-6H3.
What are the key properties of N-tert-butyl-4,6-dimethoxy-N-methyl-1,3-benzothiazole-2-sulfonamide?
N-tert-butyl-4,6-dimethoxy-N-methyl-1,3-benzothiazole-2-sulfonamide has a molecular weight of 344.46 g/mol, XLogP of 2.73, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-4,6-dimethoxy-N-methyl-1,3-benzothiazole-2-sulfonamide is sourced from PubChem (CID 175547377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).