C24H27ClN8O4S — CID 175547487
[2-[5-[4-[[2-chloro-5-[4-(2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]-4-pyridinyl]amino]butoxy]-1-methylpyrazol-4-yl]pyrimidin-4-yl] carbamate (PubChem CID 175547487) has the molecular formula C24H27ClN8O4S and a molecular weight of 559.05 g/mol. Its IUPAC name is [2-[5-[4-[[2-chloro-5-[4-(2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]-4-pyridinyl]amino]butoxy]-1-methylpyrazol-4-yl]pyrimidin-4-yl] carbamate.
| Compound Name | [2-[5-[4-[[2-chloro-5-[4-(2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]-4-pyridinyl]amino]butoxy]-1-methylpyrazol-4-yl]pyrimidin-4-yl] carbamate |
|---|---|
| PubChem CID | 175547487 |
| Molecular Formula | C24H27ClN8O4S |
| Molecular Weight | 559.05 g/mol |
| Exact Mass | 558.16 |
| IUPAC Name | [2-[5-[4-[[2-chloro-5-[4-(2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]-4-pyridinyl]amino]butoxy]-1-methylpyrazol-4-yl]pyrimidin-4-yl] carbamate |
| SMILES | Cn1ncc(-c2nccc(OC(N)=O)n2)c1OCCCCNc1cc(Cl)ncc1-c1nc(C(C)(C)O)cs1 |
| InChI | InChI=1S/C24H27ClN8O4S/c1-24(2,35)17-13-38-21(31-17)14-11-29-18(25)10-16(14)27-7-4-5-9-36-22-15(12-30-33(22)3)20-28-8-6-19(32-20)37-23(26)34/h6,8,10-13,35H,4-5,7,9H2,1-3H3,(H2,26,34)(H,27,29) |
| InChIKey | NTSRUIMFIQIDHA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 163.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.05 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|