About [4-(3-methylphenyl)-2-phenyl-5-(trifluoromethyl)-3,4-dihydropyrazol-3-yl] benzoate
[4-(3-methylphenyl)-2-phenyl-5-(trifluoromethyl)-3,4-dihydropyrazol-3-yl] benzoate (PubChem CID 175547522) has the molecular formula C24H19F3N2O2
and a molecular weight of 424.42 g/mol. Its IUPAC name is [4-(3-methylphenyl)-2-phenyl-5-(trifluoromethyl)-3,4-dihydropyrazol-3-yl] benzoate.
Molecular Properties
| Compound Name | [4-(3-methylphenyl)-2-phenyl-5-(trifluoromethyl)-3,4-dihydropyrazol-3-yl] benzoate |
| PubChem CID | 175547522 |
| Molecular Formula | C24H19F3N2O2 |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | [4-(3-methylphenyl)-2-phenyl-5-(trifluoromethyl)-3,4-dihydropyrazol-3-yl] benzoate |
| SMILES | Cc1cccc(C2C(C(F)(F)F)=NN(c3ccccc3)C2OC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C24H19F3N2O2/c1-16-9-8-12-18(15-16)20-21(24(25,26)27)28-29(19-13-6-3-7-14-19)22(20)31-23(30)17-10-4-2-5-11-17/h2-15,20,22H,1H3 |
| InChIKey | WHOIZUUKKBVBDP-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-(3-methylphenyl)-2-phenyl-5-(trifluoromethyl)-3,4-dihydropyrazol-3-yl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3-methylphenyl)-2-phenyl-5-(trifluoromethyl)-3,4-dihydropyrazol-3-yl] benzoate?
The IUPAC name of [4-(3-methylphenyl)-2-phenyl-5-(trifluoromethyl)-3,4-dihydropyrazol-3-yl] benzoate (CID 175547522) is [4-(3-methylphenyl)-2-phenyl-5-(trifluoromethyl)-3,4-dihydropyrazol-3-yl] benzoate.
What is the SMILES notation for [4-(3-methylphenyl)-2-phenyl-5-(trifluoromethyl)-3,4-dihydropyrazol-3-yl] benzoate?
The canonical SMILES for [4-(3-methylphenyl)-2-phenyl-5-(trifluoromethyl)-3,4-dihydropyrazol-3-yl] benzoate is Cc1cccc(C2C(C(F)(F)F)=NN(c3ccccc3)C2OC(=O)c2ccccc2)c1.
What is the InChIKey of [4-(3-methylphenyl)-2-phenyl-5-(trifluoromethyl)-3,4-dihydropyrazol-3-yl] benzoate?
The InChIKey is WHOIZUUKKBVBDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19F3N2O2/c1-16-9-8-12-18(15-16)20-21(24(25,26)27)28-29(19-13-6-3-7-14-19)22(20)31-23(30)17-10-4-2-5-11-17/h2-15,20,22H,1H3.
What are the key properties of [4-(3-methylphenyl)-2-phenyl-5-(trifluoromethyl)-3,4-dihydropyrazol-3-yl] benzoate?
[4-(3-methylphenyl)-2-phenyl-5-(trifluoromethyl)-3,4-dihydropyrazol-3-yl] benzoate has a molecular weight of 424.42 g/mol, XLogP of 5.70, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3-methylphenyl)-2-phenyl-5-(trifluoromethyl)-3,4-dihydropyrazol-3-yl] benzoate is sourced from PubChem (CID 175547522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).