About N,N-dimethylformamide;trichlorogold
N,N-dimethylformamide;trichlorogold (PubChem CID 175548010) has the molecular formula C3H7AuCl3NO
and a molecular weight of 376.42 g/mol. Its IUPAC name is N,N-dimethylformamide;trichlorogold.
Molecular Properties
| Compound Name | N,N-dimethylformamide;trichlorogold |
| PubChem CID | 175548010 |
| Molecular Formula | C3H7AuCl3NO |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 374.93 |
| IUPAC Name | N,N-dimethylformamide;trichlorogold |
| SMILES | CN(C)C=O.Cl[Au](Cl)Cl |
| InChI | InChI=1S/C3H7NO.Au.3ClH/c1-4(2)3-5;;;;/h3H,1-2H3;;3*1H/q;+3;;;/p-3 |
| InChIKey | JPWCZZPCPYWYRV-UHFFFAOYSA-K |
| XLogP | 1.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylformamide;trichlorogold with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylformamide;trichlorogold?
The IUPAC name of N,N-dimethylformamide;trichlorogold (CID 175548010) is N,N-dimethylformamide;trichlorogold.
What is the SMILES notation for N,N-dimethylformamide;trichlorogold?
The canonical SMILES for N,N-dimethylformamide;trichlorogold is CN(C)C=O.Cl[Au](Cl)Cl.
What is the InChIKey of N,N-dimethylformamide;trichlorogold?
The InChIKey is JPWCZZPCPYWYRV-UHFFFAOYSA-K. The full InChI is InChI=1S/C3H7NO.Au.3ClH/c1-4(2)3-5;;;;/h3H,1-2H3;;3*1H/q;+3;;;/p-3.
What are the key properties of N,N-dimethylformamide;trichlorogold?
N,N-dimethylformamide;trichlorogold has a molecular weight of 376.42 g/mol, XLogP of 1.77, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylformamide;trichlorogold is sourced from PubChem (CID 175548010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).