C15H32O3 — CID 175548282
hexane;1,3,5-trimethylcyclohexane-1,3,5-triol (PubChem CID 175548282) has the molecular formula C15H32O3 and a molecular weight of 260.42 g/mol. Its IUPAC name is hexane;1,3,5-trimethylcyclohexane-1,3,5-triol.
| Compound Name | hexane;1,3,5-trimethylcyclohexane-1,3,5-triol |
|---|---|
| PubChem CID | 175548282 |
| Molecular Formula | C15H32O3 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.24 |
| IUPAC Name | hexane;1,3,5-trimethylcyclohexane-1,3,5-triol |
| SMILES | CC1(O)CC(C)(O)CC(C)(O)C1.CCCCCC |
| InChI | InChI=1S/C9H18O3.C6H14/c1-7(10)4-8(2,11)6-9(3,12)5-7;1-3-5-6-4-2/h10-12H,4-6H2,1-3H3;3-6H2,1-2H3 |
| InChIKey | IJDIWPLTQPHGMS-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|