C11H19NOSi2 — CID 175548328
4-(2,2,3,3-tetramethyloxadisilinan-6-yl)but-2-ynenitrile (PubChem CID 175548328) has the molecular formula C11H19NOSi2 and a molecular weight of 237.45 g/mol. Its IUPAC name is 4-(2,2,3,3-tetramethyloxadisilinan-6-yl)but-2-ynenitrile.
| Compound Name | 4-(2,2,3,3-tetramethyloxadisilinan-6-yl)but-2-ynenitrile |
|---|---|
| PubChem CID | 175548328 |
| Molecular Formula | C11H19NOSi2 |
| Molecular Weight | 237.45 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 4-(2,2,3,3-tetramethyloxadisilinan-6-yl)but-2-ynenitrile |
| SMILES | C[Si]1(C)CCC(CC#CC#N)O[Si]1(C)C |
| InChI | InChI=1S/C11H19NOSi2/c1-14(2)10-8-11(7-5-6-9-12)13-15(14,3)4/h11H,7-8,10H2,1-4H3 |
| InChIKey | IPRXHIBEKHIFHD-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.45 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|