C17H13F17O2 — CID 175549130
3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl cyclohex-3-ene-1-carboxylate (PubChem CID 175549130) has the molecular formula C17H13F17O2 and a molecular weight of 572.26 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl cyclohex-3-ene-1-carboxylate.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 175549130 |
| Molecular Formula | C17H13F17O2 |
| Molecular Weight | 572.26 g/mol |
| Exact Mass | 572.06 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl cyclohex-3-ene-1-carboxylate |
| SMILES | O=C(OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C1CC=CCC1 |
| InChI | InChI=1S/C17H13F17O2/c18-10(19,6-7-36-9(35)8-4-2-1-3-5-8)11(20,21)12(22,23)13(24,25)14(26,27)15(28,29)16(30,31)17(32,33)34/h1-2,8H,3-7H2 |
| InChIKey | GCGVBPHWIJCFNM-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.26 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|