C28H42N4O5Si — CID 175549503
(2R)-1-[2-[(1S)-1-[5-[5-[tert-butyl(dimethyl)silyl]oxy-1-(1,3-oxazolidin-2-yl)indazol-3-yl]-3-pyridinyl]ethoxy]ethoxy]propan-2-ol (PubChem CID 175549503) has the molecular formula C28H42N4O5Si and a molecular weight of 542.75 g/mol. Its IUPAC name is (2R)-1-[2-[(1S)-1-[5-[5-[tert-butyl(dimethyl)silyl]oxy-1-(1,3-oxazolidin-2-yl)indazol-3-yl]-3-pyridinyl]ethoxy]ethoxy]propan-2-ol.
| Compound Name | (2R)-1-[2-[(1S)-1-[5-[5-[tert-butyl(dimethyl)silyl]oxy-1-(1,3-oxazolidin-2-yl)indazol-3-yl]-3-pyridinyl]ethoxy]ethoxy]propan-2-ol |
|---|---|
| PubChem CID | 175549503 |
| Molecular Formula | C28H42N4O5Si |
| Molecular Weight | 542.75 g/mol |
| Exact Mass | 542.29 |
| IUPAC Name | (2R)-1-[2-[(1S)-1-[5-[5-[tert-butyl(dimethyl)silyl]oxy-1-(1,3-oxazolidin-2-yl)indazol-3-yl]-3-pyridinyl]ethoxy]ethoxy]propan-2-ol |
| SMILES | C[C@H](OCCOC[C@@H](C)O)c1cncc(-c2nn(C3NCCO3)c3ccc(O[Si](C)(C)C(C)(C)C)cc23)c1 |
| InChI | InChI=1S/C28H42N4O5Si/c1-19(33)18-34-12-13-35-20(2)21-14-22(17-29-16-21)26-24-15-23(37-38(6,7)28(3,4)5)8-9-25(24)32(31-26)27-30-10-11-36-27/h8-9,14-17,19-20,27,30,33H,10-13,18H2,1-7H3/t19-,20+,27?/m1/s1 |
| InChIKey | ISNHPQKYHFOXFP-NYOMEMIMSA-N |
| XLogP | 5.03 |
| TPSA | 99.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.75 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|