About 4-[3-(4-fluorophenyl)imidazo[4,5-f][1,10]phenanthrolin-2-yl]benzoic acid
4-[3-(4-fluorophenyl)imidazo[4,5-f][1,10]phenanthrolin-2-yl]benzoic acid (PubChem CID 175549855) has the molecular formula C26H15FN4O2
and a molecular weight of 434.43 g/mol. Its IUPAC name is 4-[3-(4-fluorophenyl)imidazo[4,5-f][1,10]phenanthrolin-2-yl]benzoic acid.
Molecular Properties
| Compound Name | 4-[3-(4-fluorophenyl)imidazo[4,5-f][1,10]phenanthrolin-2-yl]benzoic acid |
| PubChem CID | 175549855 |
| Molecular Formula | C26H15FN4O2 |
| Molecular Weight | 434.43 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 4-[3-(4-fluorophenyl)imidazo[4,5-f][1,10]phenanthrolin-2-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2nc3c4cccnc4c4ncccc4c3n2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C26H15FN4O2/c27-17-9-11-18(12-10-17)31-24-20-4-2-14-29-22(20)21-19(3-1-13-28-21)23(24)30-25(31)15-5-7-16(8-6-15)26(32)33/h1-14H,(H,32,33) |
| InChIKey | ZUPGQZQDCPPKEM-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.43 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-(4-fluorophenyl)imidazo[4,5-f][1,10]phenanthrolin-2-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(4-fluorophenyl)imidazo[4,5-f][1,10]phenanthrolin-2-yl]benzoic acid?
The IUPAC name of 4-[3-(4-fluorophenyl)imidazo[4,5-f][1,10]phenanthrolin-2-yl]benzoic acid (CID 175549855) is 4-[3-(4-fluorophenyl)imidazo[4,5-f][1,10]phenanthrolin-2-yl]benzoic acid.
What is the SMILES notation for 4-[3-(4-fluorophenyl)imidazo[4,5-f][1,10]phenanthrolin-2-yl]benzoic acid?
The canonical SMILES for 4-[3-(4-fluorophenyl)imidazo[4,5-f][1,10]phenanthrolin-2-yl]benzoic acid is O=C(O)c1ccc(-c2nc3c4cccnc4c4ncccc4c3n2-c2ccc(F)cc2)cc1.
What is the InChIKey of 4-[3-(4-fluorophenyl)imidazo[4,5-f][1,10]phenanthrolin-2-yl]benzoic acid?
The InChIKey is ZUPGQZQDCPPKEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H15FN4O2/c27-17-9-11-18(12-10-17)31-24-20-4-2-14-29-22(20)21-19(3-1-13-28-21)23(24)30-25(31)15-5-7-16(8-6-15)26(32)33/h1-14H,(H,32,33).
What are the key properties of 4-[3-(4-fluorophenyl)imidazo[4,5-f][1,10]phenanthrolin-2-yl]benzoic acid?
4-[3-(4-fluorophenyl)imidazo[4,5-f][1,10]phenanthrolin-2-yl]benzoic acid has a molecular weight of 434.43 g/mol, XLogP of 5.63, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(4-fluorophenyl)imidazo[4,5-f][1,10]phenanthrolin-2-yl]benzoic acid is sourced from PubChem (CID 175549855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).