C26H15FN4O2 — CID 175549855
4-[3-(4-fluorophenyl)imidazo[4,5-f][1,10]phenanthrolin-2-yl]benzoic acid (PubChem CID 175549855) has the molecular formula C26H15FN4O2 and a molecular weight of 434.43 g/mol. Its IUPAC name is 4-[3-(4-fluorophenyl)imidazo[4,5-f][1,10]phenanthrolin-2-yl]benzoic acid.
| Compound Name | 4-[3-(4-fluorophenyl)imidazo[4,5-f][1,10]phenanthrolin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 175549855 |
| Molecular Formula | C26H15FN4O2 |
| Molecular Weight | 434.43 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 4-[3-(4-fluorophenyl)imidazo[4,5-f][1,10]phenanthrolin-2-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2nc3c4cccnc4c4ncccc4c3n2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C26H15FN4O2/c27-17-9-11-18(12-10-17)31-24-20-4-2-14-29-22(20)21-19(3-1-13-28-21)23(24)30-25(31)15-5-7-16(8-6-15)26(32)33/h1-14H,(H,32,33) |
| InChIKey | ZUPGQZQDCPPKEM-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.43 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|