About 3-(2-phenylphenyl)sulfonyl-3,4-dihydrochromen-2-one
3-(2-phenylphenyl)sulfonyl-3,4-dihydrochromen-2-one (PubChem CID 175550631) has the molecular formula C21H16O4S
and a molecular weight of 364.42 g/mol. Its IUPAC name is 3-(2-phenylphenyl)sulfonyl-3,4-dihydrochromen-2-one.
Molecular Properties
| Compound Name | 3-(2-phenylphenyl)sulfonyl-3,4-dihydrochromen-2-one |
| PubChem CID | 175550631 |
| Molecular Formula | C21H16O4S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | 3-(2-phenylphenyl)sulfonyl-3,4-dihydrochromen-2-one |
| SMILES | O=C1Oc2ccccc2CC1S(=O)(=O)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C21H16O4S/c22-21-20(14-16-10-4-6-12-18(16)25-21)26(23,24)19-13-7-5-11-17(19)15-8-2-1-3-9-15/h1-13,20H,14H2 |
| InChIKey | LLZVNIPTRZGNDL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-phenylphenyl)sulfonyl-3,4-dihydrochromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-phenylphenyl)sulfonyl-3,4-dihydrochromen-2-one?
The IUPAC name of 3-(2-phenylphenyl)sulfonyl-3,4-dihydrochromen-2-one (CID 175550631) is 3-(2-phenylphenyl)sulfonyl-3,4-dihydrochromen-2-one.
What is the SMILES notation for 3-(2-phenylphenyl)sulfonyl-3,4-dihydrochromen-2-one?
The canonical SMILES for 3-(2-phenylphenyl)sulfonyl-3,4-dihydrochromen-2-one is O=C1Oc2ccccc2CC1S(=O)(=O)c1ccccc1-c1ccccc1.
What is the InChIKey of 3-(2-phenylphenyl)sulfonyl-3,4-dihydrochromen-2-one?
The InChIKey is LLZVNIPTRZGNDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16O4S/c22-21-20(14-16-10-4-6-12-18(16)25-21)26(23,24)19-13-7-5-11-17(19)15-8-2-1-3-9-15/h1-13,20H,14H2.
What are the key properties of 3-(2-phenylphenyl)sulfonyl-3,4-dihydrochromen-2-one?
3-(2-phenylphenyl)sulfonyl-3,4-dihydrochromen-2-one has a molecular weight of 364.42 g/mol, XLogP of 3.66, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-phenylphenyl)sulfonyl-3,4-dihydrochromen-2-one is sourced from PubChem (CID 175550631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).