About [3-[3-(2,4-difluorophenyl)-4-oxophthalazin-1-yl]phenyl] cyclopentanecarboxylate
[3-[3-(2,4-difluorophenyl)-4-oxophthalazin-1-yl]phenyl] cyclopentanecarboxylate (PubChem CID 175551210) has the molecular formula C26H20F2N2O3
and a molecular weight of 446.45 g/mol. Its IUPAC name is [3-[3-(2,4-difluorophenyl)-4-oxophthalazin-1-yl]phenyl] cyclopentanecarboxylate.
Molecular Properties
| Compound Name | [3-[3-(2,4-difluorophenyl)-4-oxophthalazin-1-yl]phenyl] cyclopentanecarboxylate |
| PubChem CID | 175551210 |
| Molecular Formula | C26H20F2N2O3 |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | [3-[3-(2,4-difluorophenyl)-4-oxophthalazin-1-yl]phenyl] cyclopentanecarboxylate |
| SMILES | O=C(Oc1cccc(-c2nn(-c3ccc(F)cc3F)c(=O)c3ccccc23)c1)C1CCCC1 |
| InChI | InChI=1S/C26H20F2N2O3/c27-18-12-13-23(22(28)15-18)30-25(31)21-11-4-3-10-20(21)24(29-30)17-8-5-9-19(14-17)33-26(32)16-6-1-2-7-16/h3-5,8-16H,1-2,6-7H2 |
| InChIKey | QQKWIOHKKUMDLR-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-[3-(2,4-difluorophenyl)-4-oxophthalazin-1-yl]phenyl] cyclopentanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[3-(2,4-difluorophenyl)-4-oxophthalazin-1-yl]phenyl] cyclopentanecarboxylate?
The IUPAC name of [3-[3-(2,4-difluorophenyl)-4-oxophthalazin-1-yl]phenyl] cyclopentanecarboxylate (CID 175551210) is [3-[3-(2,4-difluorophenyl)-4-oxophthalazin-1-yl]phenyl] cyclopentanecarboxylate.
What is the SMILES notation for [3-[3-(2,4-difluorophenyl)-4-oxophthalazin-1-yl]phenyl] cyclopentanecarboxylate?
The canonical SMILES for [3-[3-(2,4-difluorophenyl)-4-oxophthalazin-1-yl]phenyl] cyclopentanecarboxylate is O=C(Oc1cccc(-c2nn(-c3ccc(F)cc3F)c(=O)c3ccccc23)c1)C1CCCC1.
What is the InChIKey of [3-[3-(2,4-difluorophenyl)-4-oxophthalazin-1-yl]phenyl] cyclopentanecarboxylate?
The InChIKey is QQKWIOHKKUMDLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H20F2N2O3/c27-18-12-13-23(22(28)15-18)30-25(31)21-11-4-3-10-20(21)24(29-30)17-8-5-9-19(14-17)33-26(32)16-6-1-2-7-16/h3-5,8-16H,1-2,6-7H2.
What are the key properties of [3-[3-(2,4-difluorophenyl)-4-oxophthalazin-1-yl]phenyl] cyclopentanecarboxylate?
[3-[3-(2,4-difluorophenyl)-4-oxophthalazin-1-yl]phenyl] cyclopentanecarboxylate has a molecular weight of 446.45 g/mol, XLogP of 5.43, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[3-(2,4-difluorophenyl)-4-oxophthalazin-1-yl]phenyl] cyclopentanecarboxylate is sourced from PubChem (CID 175551210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).