About 4-[(4-amino-3,5-diethylphenoxy)methoxy]-2,6-diethylaniline
4-[(4-amino-3,5-diethylphenoxy)methoxy]-2,6-diethylaniline (PubChem CID 175551301) has the molecular formula C21H30N2O2
and a molecular weight of 342.48 g/mol. Its IUPAC name is 4-[(4-amino-3,5-diethylphenoxy)methoxy]-2,6-diethylaniline.
Molecular Properties
| Compound Name | 4-[(4-amino-3,5-diethylphenoxy)methoxy]-2,6-diethylaniline |
| PubChem CID | 175551301 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | 4-[(4-amino-3,5-diethylphenoxy)methoxy]-2,6-diethylaniline |
| SMILES | CCc1cc(OCOc2cc(CC)c(N)c(CC)c2)cc(CC)c1N |
| InChI | InChI=1S/C21H30N2O2/c1-5-14-9-18(10-15(6-2)20(14)22)24-13-25-19-11-16(7-3)21(23)17(8-4)12-19/h9-12H,5-8,13,22-23H2,1-4H3 |
| InChIKey | NPUPDIBTGCJIJS-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4-amino-3,5-diethylphenoxy)methoxy]-2,6-diethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-amino-3,5-diethylphenoxy)methoxy]-2,6-diethylaniline?
The IUPAC name of 4-[(4-amino-3,5-diethylphenoxy)methoxy]-2,6-diethylaniline (CID 175551301) is 4-[(4-amino-3,5-diethylphenoxy)methoxy]-2,6-diethylaniline.
What is the SMILES notation for 4-[(4-amino-3,5-diethylphenoxy)methoxy]-2,6-diethylaniline?
The canonical SMILES for 4-[(4-amino-3,5-diethylphenoxy)methoxy]-2,6-diethylaniline is CCc1cc(OCOc2cc(CC)c(N)c(CC)c2)cc(CC)c1N.
What is the InChIKey of 4-[(4-amino-3,5-diethylphenoxy)methoxy]-2,6-diethylaniline?
The InChIKey is NPUPDIBTGCJIJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H30N2O2/c1-5-14-9-18(10-15(6-2)20(14)22)24-13-25-19-11-16(7-3)21(23)17(8-4)12-19/h9-12H,5-8,13,22-23H2,1-4H3.
What are the key properties of 4-[(4-amino-3,5-diethylphenoxy)methoxy]-2,6-diethylaniline?
4-[(4-amino-3,5-diethylphenoxy)methoxy]-2,6-diethylaniline has a molecular weight of 342.48 g/mol, XLogP of 4.52, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-amino-3,5-diethylphenoxy)methoxy]-2,6-diethylaniline is sourced from PubChem (CID 175551301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).