C12H13F3N2O2 — CID 175551989
4-[[4-(trifluoromethyl)-2-pyridinyl]oxy]piperidine-1-carbaldehyde (PubChem CID 175551989) has the molecular formula C12H13F3N2O2 and a molecular weight of 274.24 g/mol. Its IUPAC name is 4-[[4-(trifluoromethyl)-2-pyridinyl]oxy]piperidine-1-carbaldehyde.
| Compound Name | 4-[[4-(trifluoromethyl)-2-pyridinyl]oxy]piperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 175551989 |
| Molecular Formula | C12H13F3N2O2 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 4-[[4-(trifluoromethyl)-2-pyridinyl]oxy]piperidine-1-carbaldehyde |
| SMILES | O=CN1CCC(Oc2cc(C(F)(F)F)ccn2)CC1 |
| InChI | InChI=1S/C12H13F3N2O2/c13-12(14,15)9-1-4-16-11(7-9)19-10-2-5-17(8-18)6-3-10/h1,4,7-8,10H,2-3,5-6H2 |
| InChIKey | FKASCOPWUWSKLI-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|