About azane;1,1,2-trifluoroethane;hydroiodide
azane;1,1,2-trifluoroethane;hydroiodide (PubChem CID 175552617) has the molecular formula C2H7F3IN
and a molecular weight of 228.98 g/mol. Its IUPAC name is azane;1,1,2-trifluoroethane;hydroiodide.
Molecular Properties
| Compound Name | azane;1,1,2-trifluoroethane;hydroiodide |
| PubChem CID | 175552617 |
| Molecular Formula | C2H7F3IN |
| Molecular Weight | 228.98 g/mol |
| Exact Mass | 228.96 |
| IUPAC Name | azane;1,1,2-trifluoroethane;hydroiodide |
| SMILES | FCC(F)F.I.N |
| InChI | InChI=1S/C2H3F3.HI.H3N/c3-1-2(4)5;;/h2H,1H2;1H;1H3 |
| InChIKey | ISVBPZMFVWHBHD-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.98 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze azane;1,1,2-trifluoroethane;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1,1,2-trifluoroethane;hydroiodide?
The IUPAC name of azane;1,1,2-trifluoroethane;hydroiodide (CID 175552617) is azane;1,1,2-trifluoroethane;hydroiodide.
What is the SMILES notation for azane;1,1,2-trifluoroethane;hydroiodide?
The canonical SMILES for azane;1,1,2-trifluoroethane;hydroiodide is FCC(F)F.I.N.
What is the InChIKey of azane;1,1,2-trifluoroethane;hydroiodide?
The InChIKey is ISVBPZMFVWHBHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3F3.HI.H3N/c3-1-2(4)5;;/h2H,1H2;1H;1H3.
What are the key properties of azane;1,1,2-trifluoroethane;hydroiodide?
azane;1,1,2-trifluoroethane;hydroiodide has a molecular weight of 228.98 g/mol, XLogP of 2.00, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1,1,2-trifluoroethane;hydroiodide is sourced from PubChem (CID 175552617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).