C24H24O5Si4 — CID 175552792
1,1,2,4-tetrahydroxy-2-phenoxy-3,3,4-triphenyltetrasiletane (PubChem CID 175552792) has the molecular formula C24H24O5Si4 and a molecular weight of 504.80 g/mol. Its IUPAC name is 1,1,2,4-tetrahydroxy-2-phenoxy-3,3,4-triphenyltetrasiletane.
| Compound Name | 1,1,2,4-tetrahydroxy-2-phenoxy-3,3,4-triphenyltetrasiletane |
|---|---|
| PubChem CID | 175552792 |
| Molecular Formula | C24H24O5Si4 |
| Molecular Weight | 504.80 g/mol |
| Exact Mass | 504.07 |
| IUPAC Name | 1,1,2,4-tetrahydroxy-2-phenoxy-3,3,4-triphenyltetrasiletane |
| SMILES | O[Si]1(O)[Si](O)(Oc2ccccc2)[Si](c2ccccc2)(c2ccccc2)[Si]1(O)c1ccccc1 |
| InChI | InChI=1S/C24H24O5Si4/c25-31(24-19-11-4-12-20-24)30(22-15-7-2-8-16-22,23-17-9-3-10-18-23)33(28,32(31,26)27)29-21-13-5-1-6-14-21/h1-20,25-28H |
| InChIKey | DZDWUORPDJSVIB-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.80 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|