C12H9N3O2S — CID 175553313
acetonitrile;2-thiophen-2-yl-1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione (PubChem CID 175553313) has the molecular formula C12H9N3O2S and a molecular weight of 259.29 g/mol. Its IUPAC name is acetonitrile;2-thiophen-2-yl-1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione.
| Compound Name | acetonitrile;2-thiophen-2-yl-1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione |
|---|---|
| PubChem CID | 175553313 |
| Molecular Formula | C12H9N3O2S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | acetonitrile;2-thiophen-2-yl-1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione |
| SMILES | CC#N.O=C1Nc2cc(-c3cccs3)[nH]c2C1=O |
| InChI | InChI=1S/C10H6N2O2S.C2H3N/c13-9-8-6(12-10(9)14)4-5(11-8)7-2-1-3-15-7;1-2-3/h1-4,11H,(H,12,13,14);1H3 |
| InChIKey | BTYUNGBNJSWKSE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|