C16H31ClN2 — CID 175553406
1,2-dihexyl-3-methylimidazol-3-ium chloride (PubChem CID 175553406) has the molecular formula C16H31ClN2 and a molecular weight of 286.89 g/mol. Its IUPAC name is 1,2-dihexyl-3-methylimidazol-3-ium chloride.
| Compound Name | 1,2-dihexyl-3-methylimidazol-3-ium chloride |
|---|---|
| PubChem CID | 175553406 |
| Molecular Formula | C16H31ClN2 |
| Molecular Weight | 286.89 g/mol |
| Exact Mass | 286.22 |
| IUPAC Name | 1,2-dihexyl-3-methylimidazol-3-ium chloride |
| SMILES | CCCCCCc1n(CCCCCC)cc[n+]1C.[Cl-] |
| InChI | InChI=1S/C16H31N2.ClH/c1-4-6-8-10-12-16-17(3)14-15-18(16)13-11-9-7-5-2;/h14-15H,4-13H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | BJJXQRAAGTYVMU-UHFFFAOYSA-M |
| XLogP | 1.02 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.89 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|