C25H30O5 — CID 175554352
3-(3,4-dihydroxyphenyl)-6,8-bis(3-methylbut-2-enyl)-3,4-dihydro-2H-chromene-5,7-diol (PubChem CID 175554352) has the molecular formula C25H30O5 and a molecular weight of 410.51 g/mol. Its IUPAC name is 3-(3,4-dihydroxyphenyl)-6,8-bis(3-methylbut-2-enyl)-3,4-dihydro-2H-chromene-5,7-diol.
| Compound Name | 3-(3,4-dihydroxyphenyl)-6,8-bis(3-methylbut-2-enyl)-3,4-dihydro-2H-chromene-5,7-diol |
|---|---|
| PubChem CID | 175554352 |
| Molecular Formula | C25H30O5 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 3-(3,4-dihydroxyphenyl)-6,8-bis(3-methylbut-2-enyl)-3,4-dihydro-2H-chromene-5,7-diol |
| SMILES | CC(C)=CCc1c(O)c(CC=C(C)C)c2c(c1O)CC(c1ccc(O)c(O)c1)CO2 |
| InChI | InChI=1S/C25H30O5/c1-14(2)5-8-18-23(28)19(9-6-15(3)4)25-20(24(18)29)11-17(13-30-25)16-7-10-21(26)22(27)12-16/h5-7,10,12,17,26-29H,8-9,11,13H2,1-4H3 |
| InChIKey | FSARSBOFDUBHFG-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|