C25H2Cl20O — CID 175554387
formaldehyde;bis(1,2,3,4,5-pentachloro-6-(2,3,4,5,6-pentachlorophenyl)benzene) (PubChem CID 175554387) has the molecular formula C25H2Cl20O and a molecular weight of 1027.35 g/mol. Its IUPAC name is formaldehyde;bis(1,2,3,4,5-pentachloro-6-(2,3,4,5,6-pentachlorophenyl)benzene).
| Compound Name | formaldehyde;bis(1,2,3,4,5-pentachloro-6-(2,3,4,5,6-pentachlorophenyl)benzene) |
|---|---|
| PubChem CID | 175554387 |
| Molecular Formula | C25H2Cl20O |
| Molecular Weight | 1027.35 g/mol |
| Exact Mass | 1017.39 |
| IUPAC Name | formaldehyde;bis(1,2,3,4,5-pentachloro-6-(2,3,4,5,6-pentachlorophenyl)benzene) |
| SMILES | C=O.Clc1c(Cl)c(Cl)c(-c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)c(Cl)c1Cl.Clc1c(Cl)c(Cl)c(-c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)c(Cl)c1Cl |
| InChI | InChI=1S/2C12Cl10.CH2O/c2*13-3-1(4(14)8(18)11(21)7(3)17)2-5(15)9(19)12(22)10(20)6(2)16;1-2/h;;1H2 |
| InChIKey | HTZWTICXCPNZDV-UHFFFAOYSA-N |
| XLogP | 19.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1027.35 |
| LogP ≤ 5 | 19.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|