About 1-ethyl-3-methyl-2H-imidazole;bis(trifluoroborane)
1-ethyl-3-methyl-2H-imidazole;bis(trifluoroborane) (PubChem CID 175554894) has the molecular formula C6H12B2F6N2
and a molecular weight of 247.79 g/mol. Its IUPAC name is 1-ethyl-3-methyl-2H-imidazole;bis(trifluoroborane).
Molecular Properties
| Compound Name | 1-ethyl-3-methyl-2H-imidazole;bis(trifluoroborane) |
| PubChem CID | 175554894 |
| Molecular Formula | C6H12B2F6N2 |
| Molecular Weight | 247.79 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 1-ethyl-3-methyl-2H-imidazole;bis(trifluoroborane) |
| SMILES | CCN1C=CN(C)C1.FB(F)F.FB(F)F |
| InChI | InChI=1S/C6H12N2.2BF3/c1-3-8-5-4-7(2)6-8;2*2-1(3)4/h4-5H,3,6H2,1-2H3;; |
| InChIKey | RNCICKQIRIZZRD-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.79 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-3-methyl-2H-imidazole;bis(trifluoroborane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-methyl-2H-imidazole;bis(trifluoroborane)?
The IUPAC name of 1-ethyl-3-methyl-2H-imidazole;bis(trifluoroborane) (CID 175554894) is 1-ethyl-3-methyl-2H-imidazole;bis(trifluoroborane).
What is the SMILES notation for 1-ethyl-3-methyl-2H-imidazole;bis(trifluoroborane)?
The canonical SMILES for 1-ethyl-3-methyl-2H-imidazole;bis(trifluoroborane) is CCN1C=CN(C)C1.FB(F)F.FB(F)F.
What is the InChIKey of 1-ethyl-3-methyl-2H-imidazole;bis(trifluoroborane)?
The InChIKey is RNCICKQIRIZZRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2.2BF3/c1-3-8-5-4-7(2)6-8;2*2-1(3)4/h4-5H,3,6H2,1-2H3;;.
What are the key properties of 1-ethyl-3-methyl-2H-imidazole;bis(trifluoroborane)?
1-ethyl-3-methyl-2H-imidazole;bis(trifluoroborane) has a molecular weight of 247.79 g/mol, XLogP of 2.44, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-methyl-2H-imidazole;bis(trifluoroborane) is sourced from PubChem (CID 175554894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).