About 4-bromo-2-iodo-1-(1,2,2-trifluoroethyl)indole
4-bromo-2-iodo-1-(1,2,2-trifluoroethyl)indole (PubChem CID 175555491) has the molecular formula C10H6BrF3IN
and a molecular weight of 403.97 g/mol. Its IUPAC name is 4-bromo-2-iodo-1-(1,2,2-trifluoroethyl)indole.
Molecular Properties
| Compound Name | 4-bromo-2-iodo-1-(1,2,2-trifluoroethyl)indole |
| PubChem CID | 175555491 |
| Molecular Formula | C10H6BrF3IN |
| Molecular Weight | 403.97 g/mol |
| Exact Mass | 402.87 |
| IUPAC Name | 4-bromo-2-iodo-1-(1,2,2-trifluoroethyl)indole |
| SMILES | FC(F)C(F)n1c(I)cc2c(Br)cccc21 |
| InChI | InChI=1S/C10H6BrF3IN/c11-6-2-1-3-7-5(6)4-8(15)16(7)10(14)9(12)13/h1-4,9-10H |
| InChIKey | YGFBTAYIWWVJFC-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.97 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-2-iodo-1-(1,2,2-trifluoroethyl)indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-iodo-1-(1,2,2-trifluoroethyl)indole?
The IUPAC name of 4-bromo-2-iodo-1-(1,2,2-trifluoroethyl)indole (CID 175555491) is 4-bromo-2-iodo-1-(1,2,2-trifluoroethyl)indole.
What is the SMILES notation for 4-bromo-2-iodo-1-(1,2,2-trifluoroethyl)indole?
The canonical SMILES for 4-bromo-2-iodo-1-(1,2,2-trifluoroethyl)indole is FC(F)C(F)n1c(I)cc2c(Br)cccc21.
What is the InChIKey of 4-bromo-2-iodo-1-(1,2,2-trifluoroethyl)indole?
The InChIKey is YGFBTAYIWWVJFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6BrF3IN/c11-6-2-1-3-7-5(6)4-8(15)16(7)10(14)9(12)13/h1-4,9-10H.
What are the key properties of 4-bromo-2-iodo-1-(1,2,2-trifluoroethyl)indole?
4-bromo-2-iodo-1-(1,2,2-trifluoroethyl)indole has a molecular weight of 403.97 g/mol, XLogP of 4.74, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-iodo-1-(1,2,2-trifluoroethyl)indole is sourced from PubChem (CID 175555491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).