About trifluoromethyl cyclohexene-1-sulfonate
trifluoromethyl cyclohexene-1-sulfonate (PubChem CID 175555743) has the molecular formula C7H9F3O3S
and a molecular weight of 230.21 g/mol. Its IUPAC name is trifluoromethyl cyclohexene-1-sulfonate.
Molecular Properties
| Compound Name | trifluoromethyl cyclohexene-1-sulfonate |
| PubChem CID | 175555743 |
| Molecular Formula | C7H9F3O3S |
| Molecular Weight | 230.21 g/mol |
| Exact Mass | 230.02 |
| IUPAC Name | trifluoromethyl cyclohexene-1-sulfonate |
| SMILES | O=S(=O)(OC(F)(F)F)C1=CCCCC1 |
| InChI | InChI=1S/C7H9F3O3S/c8-7(9,10)13-14(11,12)6-4-2-1-3-5-6/h4H,1-3,5H2 |
| InChIKey | RZBFNMOPAHFPBY-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.21 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze trifluoromethyl cyclohexene-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trifluoromethyl cyclohexene-1-sulfonate?
The IUPAC name of trifluoromethyl cyclohexene-1-sulfonate (CID 175555743) is trifluoromethyl cyclohexene-1-sulfonate.
What is the SMILES notation for trifluoromethyl cyclohexene-1-sulfonate?
The canonical SMILES for trifluoromethyl cyclohexene-1-sulfonate is O=S(=O)(OC(F)(F)F)C1=CCCCC1.
What is the InChIKey of trifluoromethyl cyclohexene-1-sulfonate?
The InChIKey is RZBFNMOPAHFPBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F3O3S/c8-7(9,10)13-14(11,12)6-4-2-1-3-5-6/h4H,1-3,5H2.
What are the key properties of trifluoromethyl cyclohexene-1-sulfonate?
trifluoromethyl cyclohexene-1-sulfonate has a molecular weight of 230.21 g/mol, XLogP of 2.31, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trifluoromethyl cyclohexene-1-sulfonate is sourced from PubChem (CID 175555743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).